ID | 1737 |
Name | Chelirubine |
Pubchem ID | 161243 |
KEGG ID | C06327 |
Source | Dicranostigma lactucoides |
Type | Natural |
Function | Nematocidal |
Drug Like Properties | Yes |
Molecular Weight | 362.36 |
Exact mass | 362.102848 |
Molecular formula | C21H16NO5+ |
XlogP | 4.4 |
Topological Polar Surface Area | 50 |
H-Bond Donor | 0 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 1 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | C[N+]1=CC2=C3C(=CC(=C2C4=C1C5=CC6=C(C=C5C=C4)OCO6)OC)OCO3 |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Dostal,Fitoterapia,63,(1992),67 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 3135 |
Name | Sanguinarine |
Pubchem ID | 5154 |
KEGG ID | C06162 |
Source | Dicranostigma lactucoides |
Type | Natural |
Function | Anti-inflammatory |
Drug Like Properties | Yes |
Molecular Weight | 332.33 |
Exact mass | 332.092283 |
Molecular formula | C20H14NO4+ |
XlogP | 4.4 |
Topological Polar Surface Area | 40.8 |
H-Bond Donor | 0 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 0 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6 |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Dostal,Fitoterapia,63,(1992),67 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 3149 |
Name | Sanguinarine |
Pubchem ID | 5154 |
KEGG ID | C06162 |
Source | Dicranostigma lactucoides |
Type | Natural |
Function | Glutamate decarboxylase inhibitor |
Drug Like Properties | Yes |
Molecular Weight | 332.33 |
Exact mass | 332.092283 |
Molecular formula | C20H14NO4+ |
XlogP | 4.4 |
Topological Polar Surface Area | 40.8 |
H-Bond Donor | 0 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 0 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6 |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Dostal,Fitoterapia,63,(1992),67 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 3163 |
Name | Sanguinarine |
Pubchem ID | 5154 |
KEGG ID | C06162 |
Source | Dicranostigma lactucoides |
Type | Natural |
Function | Antibacterial |
Drug Like Properties | Yes |
Molecular Weight | 332.33 |
Exact mass | 332.092283 |
Molecular formula | C20H14NO4+ |
XlogP | 4.4 |
Topological Polar Surface Area | 40.8 |
H-Bond Donor | 0 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 0 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6 |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Dostal,Fitoterapia,63,(1992),67 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 3177 |
Name | Sanguinarine |
Pubchem ID | 5154 |
KEGG ID | C06162 |
Source | Dicranostigma lactucoides |
Type | Natural |
Function | Cytotoxic |
Drug Like Properties | Yes |
Molecular Weight | 332.33 |
Exact mass | 332.092283 |
Molecular formula | C20H14NO4+ |
XlogP | 4.4 |
Topological Polar Surface Area | 40.8 |
H-Bond Donor | 0 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 0 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6 |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Dostal,Fitoterapia,63,(1992),67 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |